C13H14Cl2FNO2 — CID 110888815
2,2-dichloro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 110888815) has the molecular formula C13H14Cl2FNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110888815 |
| Molecular Formula | C13H14Cl2FNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2,2-dichloro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCC(O)c2ccc(F)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H14Cl2FNO2/c1-12(7-13(12,14)15)11(19)17-6-10(18)8-2-4-9(16)5-3-8/h2-5,10,18H,6-7H2,1H3,(H,17,19) |
| InChIKey | PLVDFVZSBCGIAB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|