C16H18N2O4 — CID 110893787
N'-(2-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]oxamide (PubChem CID 110893787) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N'-(2-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]oxamide.
| Compound Name | N'-(2-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]oxamide |
|---|---|
| PubChem CID | 110893787 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N'-(2-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C16H18N2O4/c1-2-11-6-3-4-7-12(11)18-16(21)15(20)17-10-13(19)14-8-5-9-22-14/h3-9,13,19H,2,10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | SXRUUFSFBKZLMD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|