C14H19ClN2O3 — CID 110896626
N-[2-(3-chlorophenoxy)ethyl]-3-hydroxypiperidine-1-carboxamide (PubChem CID 110896626) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-3-hydroxypiperidine-1-carboxamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110896626 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-3-hydroxypiperidine-1-carboxamide |
| SMILES | O=C(NCCOc1cccc(Cl)c1)N1CCCC(O)C1 |
| InChI | InChI=1S/C14H19ClN2O3/c15-11-3-1-5-13(9-11)20-8-6-16-14(19)17-7-2-4-12(18)10-17/h1,3,5,9,12,18H,2,4,6-8,10H2,(H,16,19) |
| InChIKey | AEZRFAYZSKIVMV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|