C12H14F2N2O2 — CID 110897257
4-[2-(2,6-difluorophenyl)-2-hydroxyethyl]piperazin-2-one (PubChem CID 110897257) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-[2-(2,6-difluorophenyl)-2-hydroxyethyl]piperazin-2-one.
| Compound Name | 4-[2-(2,6-difluorophenyl)-2-hydroxyethyl]piperazin-2-one |
|---|---|
| PubChem CID | 110897257 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-[2-(2,6-difluorophenyl)-2-hydroxyethyl]piperazin-2-one |
| SMILES | O=C1CN(CC(O)c2c(F)cccc2F)CCN1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-8-2-1-3-9(14)12(8)10(17)6-16-5-4-15-11(18)7-16/h1-3,10,17H,4-7H2,(H,15,18) |
| InChIKey | BSVVCNVMUPZZDL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |