C14H20F2N2OS — CID 126759659
1-(2,6-difluorophenyl)-2-[4-(1-sulfanylethyl)piperazin-1-yl]ethanol (PubChem CID 126759659) has the molecular formula C14H20F2N2OS and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[4-(1-sulfanylethyl)piperazin-1-yl]ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-[4-(1-sulfanylethyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 126759659 |
| Molecular Formula | C14H20F2N2OS |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[4-(1-sulfanylethyl)piperazin-1-yl]ethanol |
| SMILES | CC(S)N1CCN(CC(O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H20F2N2OS/c1-10(20)18-7-5-17(6-8-18)9-13(19)14-11(15)3-2-4-12(14)16/h2-4,10,13,19-20H,5-9H2,1H3 |
| InChIKey | GZSUZLXLWXHRAJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|