C16H24ClFN2O — CID 112539561
2-(2-chloro-6-fluorophenyl)-2-[4-(2-methylpropyl)piperazin-1-yl]ethanol (PubChem CID 112539561) has the molecular formula C16H24ClFN2O and a molecular weight of 314.83 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-2-[4-(2-methylpropyl)piperazin-1-yl]ethanol.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-2-[4-(2-methylpropyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 112539561 |
| Molecular Formula | C16H24ClFN2O |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-2-[4-(2-methylpropyl)piperazin-1-yl]ethanol |
| SMILES | CC(C)CN1CCN(C(CO)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H24ClFN2O/c1-12(2)10-19-6-8-20(9-7-19)15(11-21)16-13(17)4-3-5-14(16)18/h3-5,12,15,21H,6-11H2,1-2H3 |
| InChIKey | VYMQSRLJRPGCDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |