C17H26ClFN4 — CID 111054485
2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111054485) has the molecular formula C17H26ClFN4 and a molecular weight of 340.87 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111054485 |
| Molecular Formula | C17H26ClFN4 |
| Molecular Weight | 340.87 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCC(c1c(F)cccc1Cl)N1CCCC1)N(C)C |
| InChI | InChI=1S/C17H26ClFN4/c1-21(2)17(22(3)4)20-12-15(23-10-5-6-11-23)16-13(18)8-7-9-14(16)19/h7-9,15H,5-6,10-12H2,1-4H3 |
| InChIKey | JHQBDETVNRFBRX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|