C15H18F3N3O2 — CID 110898444
1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-(4-fluorophenoxy)propan-2-ol (PubChem CID 110898444) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-(4-fluorophenoxy)propan-2-ol.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-(4-fluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 110898444 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]-3-(4-fluorophenoxy)propan-2-ol |
| SMILES | CN(Cc1nccn1C(F)F)CC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C15H18F3N3O2/c1-20(9-14-19-6-7-21(14)15(17)18)8-12(22)10-23-13-4-2-11(16)3-5-13/h2-7,12,15,22H,8-10H2,1H3 |
| InChIKey | PCVFUNYKDYFZNJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |