C22H25NO4 — CID 11089893
N-(3-phenylmethoxyphenyl)-1,4-dioxaspiro[4.5]decane-6-carboxamide (PubChem CID 11089893) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is N-(3-phenylmethoxyphenyl)-1,4-dioxaspiro[4.5]decane-6-carboxamide.
| Compound Name | N-(3-phenylmethoxyphenyl)-1,4-dioxaspiro[4.5]decane-6-carboxamide |
|---|---|
| PubChem CID | 11089893 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-(3-phenylmethoxyphenyl)-1,4-dioxaspiro[4.5]decane-6-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2ccccc2)c1)C1CCCCC12OCCO2 |
| InChI | InChI=1S/C22H25NO4/c24-21(20-11-4-5-12-22(20)26-13-14-27-22)23-18-9-6-10-19(15-18)25-16-17-7-2-1-3-8-17/h1-3,6-10,15,20H,4-5,11-14,16H2,(H,23,24) |
| InChIKey | WDJUKCXFYOKPGP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |