C18H17F2NO3 — CID 110899045
4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-oxobutanamide (PubChem CID 110899045) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110899045 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)NCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F2NO3/c19-14-5-1-12(2-6-14)16(22)9-10-18(24)21-11-17(23)13-3-7-15(20)8-4-13/h1-8,17,23H,9-11H2,(H,21,24) |
| InChIKey | YEGSWPPQPMZBTK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |