C20H36O4Si — CID 11089939
trans-diethyl (2S,3R)-2-hexyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 11089939) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is trans-diethyl (2S,3R)-2-hexyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2S,3R)-2-hexyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11089939 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | trans-diethyl (2S,3R)-2-hexyl-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCCCCC[C@H]1[C@H](/C=C/[Si](C)(C)C)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H36O4Si/c1-7-10-11-12-13-16-17(14-15-25(4,5)6)20(16,18(21)23-8-2)19(22)24-9-3/h14-17H,7-13H2,1-6H3/b15-14+/t16-,17-/m0/s1 |
| InChIKey | JEEDYWPFDPXDSX-WLFRDLTRSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|