C19H28FN3O2 — CID 110901440
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 110901440) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 110901440 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccc(F)cc2)CC1)N1CCCC(CO)C1 |
| InChI | InChI=1S/C19H28FN3O2/c20-17-5-3-15(4-6-17)12-22-10-7-18(8-11-22)21-19(25)23-9-1-2-16(13-23)14-24/h3-6,16,18,24H,1-2,7-14H2,(H,21,25) |
| InChIKey | KERIQUPLDDRGBB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |