C16H22N2O3 — CID 110901731
N-(2,4-dimethylphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetamide (PubChem CID 110901731) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 110901731 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N2CCC(CO)CC2)c(C)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-3-4-14(12(2)9-11)17-15(20)16(21)18-7-5-13(10-19)6-8-18/h3-4,9,13,19H,5-8,10H2,1-2H3,(H,17,20) |
| InChIKey | ODBALZBNLPENIT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|