C19H29N3O2 — CID 108504667
N-[4-(diethylamino)-2-methylphenyl]-2-(4-methylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108504667) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(4-methylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(4-methylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108504667 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(4-methylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)N2CCC(C)CC2)c(C)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-5-21(6-2)16-7-8-17(15(4)13-16)20-18(23)19(24)22-11-9-14(3)10-12-22/h7-8,13-14H,5-6,9-12H2,1-4H3,(H,20,23) |
| InChIKey | USXLKXHBWXGHOF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|