C20H34N4O — CID 113104284
4-butan-2-yl-N-[4-(diethylamino)-2-methylphenyl]piperazine-1-carboxamide (PubChem CID 113104284) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 4-butan-2-yl-N-[4-(diethylamino)-2-methylphenyl]piperazine-1-carboxamide.
| Compound Name | 4-butan-2-yl-N-[4-(diethylamino)-2-methylphenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113104284 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 4-butan-2-yl-N-[4-(diethylamino)-2-methylphenyl]piperazine-1-carboxamide |
| SMILES | CCC(C)N1CCN(C(=O)Nc2ccc(N(CC)CC)cc2C)CC1 |
| InChI | InChI=1S/C20H34N4O/c1-6-17(5)23-11-13-24(14-12-23)20(25)21-19-10-9-18(15-16(19)4)22(7-2)8-3/h9-10,15,17H,6-8,11-14H2,1-5H3,(H,21,25) |
| InChIKey | HQGPDRRGHRKBHP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|