C18H26N4O3 — CID 108508432
2-(4-acetylpiperazin-1-yl)-N-[4-(diethylamino)phenyl]-2-oxoacetamide (PubChem CID 108508432) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-[4-(diethylamino)phenyl]-2-oxoacetamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N-[4-(diethylamino)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108508432 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-[4-(diethylamino)phenyl]-2-oxoacetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)N2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C18H26N4O3/c1-4-20(5-2)16-8-6-15(7-9-16)19-17(24)18(25)22-12-10-21(11-13-22)14(3)23/h6-9H,4-5,10-13H2,1-3H3,(H,19,24) |
| InChIKey | MQVUCBKPNGRQTF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|