C16H18F2N2O2 — CID 110902098
1-[4-(difluoromethoxy)phenyl]-2-(1-pyridin-2-ylethylamino)ethanol (PubChem CID 110902098) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-(1-pyridin-2-ylethylamino)ethanol.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-(1-pyridin-2-ylethylamino)ethanol |
|---|---|
| PubChem CID | 110902098 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-(1-pyridin-2-ylethylamino)ethanol |
| SMILES | CC(NCC(O)c1ccc(OC(F)F)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H18F2N2O2/c1-11(14-4-2-3-9-19-14)20-10-15(21)12-5-7-13(8-6-12)22-16(17)18/h2-9,11,15-16,20-21H,10H2,1H3 |
| InChIKey | PHUJDGDYVDZMRA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |