C19H23NO2 — CID 110902815
[5-[[cyclopropyl(phenyl)methyl]amino]-2-ethoxyphenyl]methanol (PubChem CID 110902815) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [5-[[cyclopropyl(phenyl)methyl]amino]-2-ethoxyphenyl]methanol.
| Compound Name | [5-[[cyclopropyl(phenyl)methyl]amino]-2-ethoxyphenyl]methanol |
|---|---|
| PubChem CID | 110902815 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [5-[[cyclopropyl(phenyl)methyl]amino]-2-ethoxyphenyl]methanol |
| SMILES | CCOc1ccc(NC(c2ccccc2)C2CC2)cc1CO |
| InChI | InChI=1S/C19H23NO2/c1-2-22-18-11-10-17(12-16(18)13-21)20-19(15-8-9-15)14-6-4-3-5-7-14/h3-7,10-12,15,19-21H,2,8-9,13H2,1H3 |
| InChIKey | HIBDFUFYSNMJAV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|