C16H26N2O3 — CID 110904027
1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-propylcyclohexyl)urea (PubChem CID 110904027) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-propylcyclohexyl)urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-propylcyclohexyl)urea |
|---|---|
| PubChem CID | 110904027 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-propylcyclohexyl)urea |
| SMILES | CCCC1CCC(NC(=O)NCC(O)c2ccco2)CC1 |
| InChI | InChI=1S/C16H26N2O3/c1-2-4-12-6-8-13(9-7-12)18-16(20)17-11-14(19)15-5-3-10-21-15/h3,5,10,12-14,19H,2,4,6-9,11H2,1H3,(H2,17,18,20) |
| InChIKey | GXXOEDIXTHDHRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |