C21H30N2O5 — CID 11090420
methyl (2S)-2-[[(2R)-2-benzamido-2-(1-hydroxycyclohexyl)acetyl]amino]-3-methylbutanoate (PubChem CID 11090420) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-benzamido-2-(1-hydroxycyclohexyl)acetyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-benzamido-2-(1-hydroxycyclohexyl)acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 11090420 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-benzamido-2-(1-hydroxycyclohexyl)acetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](NC(=O)c1ccccc1)C1(O)CCCCC1)C(C)C |
| InChI | InChI=1S/C21H30N2O5/c1-14(2)16(20(26)28-3)22-19(25)17(21(27)12-8-5-9-13-21)23-18(24)15-10-6-4-7-11-15/h4,6-7,10-11,14,16-17,27H,5,8-9,12-13H2,1-3H3,(H,22,25)(H,23,24)/t16-,17-/m0/s1 |
| InChIKey | KAOPIVIXAMDLLC-IRXDYDNUSA-N |
| XLogP | 1.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |