C21H21N3O5 — CID 11090541
ethyl 10-(ethoxycarbonylamino)-1,3-dihydro-[1,3]oxazino[4,5-c]acridine-4-carboxylate (PubChem CID 11090541) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is ethyl 10-(ethoxycarbonylamino)-1,3-dihydro-[1,3]oxazino[4,5-c]acridine-4-carboxylate.
| Compound Name | ethyl 10-(ethoxycarbonylamino)-1,3-dihydro-[1,3]oxazino[4,5-c]acridine-4-carboxylate |
|---|---|
| PubChem CID | 11090541 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 10-(ethoxycarbonylamino)-1,3-dihydro-[1,3]oxazino[4,5-c]acridine-4-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2cc3ccc4c(c3nc2c1)COCN4C(=O)OCC |
| InChI | InChI=1S/C21H21N3O5/c1-3-28-20(25)22-15-7-5-13-9-14-6-8-18-16(19(14)23-17(13)10-15)11-27-12-24(18)21(26)29-4-2/h5-10H,3-4,11-12H2,1-2H3,(H,22,25) |
| InChIKey | YRZCISDEWRZORR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|