C23H25NO5 — CID 11090544
benzhydryl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate (PubChem CID 11090544) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is benzhydryl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate.
| Compound Name | benzhydryl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 11090544 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | benzhydryl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N[C@@H]1[C@@H](C)C(=O)CC(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO5/c1-14(21-20(15(2)25)23(28)24-21)18(26)13-19(27)29-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14-15,20-22,25H,13H2,1-2H3,(H,24,28)/t14-,15+,20+,21+/m0/s1 |
| InChIKey | MAFORPIDYBNGEJ-REABXYAWSA-N |
| XLogP | 2.41 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|