C14H19ClN4O — CID 110905682
2-[4-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,5-dimethylpyrazol-1-yl]ethanol (PubChem CID 110905682) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-[4-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,5-dimethylpyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,5-dimethylpyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 110905682 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[4-[[(6-chloro-3-pyridinyl)methylamino]methyl]-3,5-dimethylpyrazol-1-yl]ethanol |
| SMILES | Cc1nn(CCO)c(C)c1CNCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H19ClN4O/c1-10-13(11(2)19(18-10)5-6-20)9-16-7-12-3-4-14(15)17-8-12/h3-4,8,16,20H,5-7,9H2,1-2H3 |
| InChIKey | BGINHJATJBGBKR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|