C17H24F3NO3 — CID 110906834
1-(4-ethoxypiperidin-1-yl)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol (PubChem CID 110906834) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-(4-ethoxypiperidin-1-yl)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(4-ethoxypiperidin-1-yl)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 110906834 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-(4-ethoxypiperidin-1-yl)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol |
| SMILES | CCOC1CCN(CC(O)COc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H24F3NO3/c1-2-23-15-6-8-21(9-7-15)11-14(22)12-24-16-5-3-4-13(10-16)17(18,19)20/h3-5,10,14-15,22H,2,6-9,11-12H2,1H3 |
| InChIKey | TXXDCCNXOREEQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |