C17H17N3O7S — CID 11090819
(2S)-2-[benzenesulfonylcarbamoyl-[(2-nitrophenyl)methyl]amino]propanoic acid (PubChem CID 11090819) has the molecular formula C17H17N3O7S and a molecular weight of 407.40 g/mol. Its IUPAC name is (2S)-2-[benzenesulfonylcarbamoyl-[(2-nitrophenyl)methyl]amino]propanoic acid.
| Compound Name | (2S)-2-[benzenesulfonylcarbamoyl-[(2-nitrophenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11090819 |
| Molecular Formula | C17H17N3O7S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (2S)-2-[benzenesulfonylcarbamoyl-[(2-nitrophenyl)methyl]amino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(Cc1ccccc1[N+](=O)[O-])C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O7S/c1-12(16(21)22)19(11-13-7-5-6-10-15(13)20(24)25)17(23)18-28(26,27)14-8-3-2-4-9-14/h2-10,12H,11H2,1H3,(H,18,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | LMDWPERANMECHL-LBPRGKRZSA-N |
| XLogP | 1.97 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|