C17H18FN3O5S — CID 101074343
(2S)-2-[benzyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide (PubChem CID 101074343) has the molecular formula C17H18FN3O5S and a molecular weight of 395.41 g/mol. Its IUPAC name is (2S)-2-[benzyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide.
| Compound Name | (2S)-2-[benzyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 101074343 |
| Molecular Formula | C17H18FN3O5S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-[benzyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide |
| SMILES | C[C@@H](C(=O)NO)N(Cc1ccccc1)C(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O5S/c1-12(16(22)19-24)21(11-13-5-3-2-4-6-13)17(23)20-27(25,26)15-9-7-14(18)8-10-15/h2-10,12,24H,11H2,1H3,(H,19,22)(H,20,23)/t12-/m0/s1 |
| InChIKey | DGZJHVCWFBMZAA-LBPRGKRZSA-N |
| XLogP | 1.62 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|