C17H16ClFN2O5S — CID 23645817
2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]propanoic acid (PubChem CID 23645817) has the molecular formula C17H16ClFN2O5S and a molecular weight of 414.84 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]propanoic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23645817 |
| Molecular Formula | C17H16ClFN2O5S |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(Cc1ccccc1Cl)C(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16ClFN2O5S/c1-11(16(22)23)21(10-12-4-2-3-5-15(12)18)17(24)20-27(25,26)14-8-6-13(19)7-9-14/h2-9,11H,10H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | CNJNHNFUHQQPCI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |