C18H22N2O2 — CID 110908638
2-[cyclopropyl-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]amino]ethanol (PubChem CID 110908638) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[cyclopropyl-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]amino]ethanol.
| Compound Name | 2-[cyclopropyl-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 110908638 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-[cyclopropyl-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]amino]ethanol |
| SMILES | OCCN(Cc1ccc(OCc2ccccn2)cc1)C1CC1 |
| InChI | InChI=1S/C18H22N2O2/c21-12-11-20(17-6-7-17)13-15-4-8-18(9-5-15)22-14-16-3-1-2-10-19-16/h1-5,8-10,17,21H,6-7,11-14H2 |
| InChIKey | QLTMWGPFMSBLIS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |