C26H27NO2 — CID 58095659
[4-[(2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]methanol (PubChem CID 58095659) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is [4-[(2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]methanol.
| Compound Name | [4-[(2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]methanol |
|---|---|
| PubChem CID | 58095659 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [4-[(2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]methanol |
| SMILES | OCc1ccc([C@]2(c3ccc(OCc4ccccn4)cc3)CC3CCC2C3)cc1 |
| InChI | InChI=1S/C26H27NO2/c28-17-19-4-7-21(8-5-19)26(16-20-6-9-23(26)15-20)22-10-12-25(13-11-22)29-18-24-3-1-2-14-27-24/h1-5,7-8,10-14,20,23,28H,6,9,15-18H2/t20?,23?,26-/m0/s1 |
| InChIKey | XMAYHDSPWKHDLF-CQEMHVLCSA-N |
| XLogP | 5.26 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |