C30H32N2O2 — CID 123800423
3-(dimethylamino)-1-[4-[(1R,2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]prop-2-en-1-one (PubChem CID 123800423) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[4-[(1R,2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]prop-2-en-1-one.
| Compound Name | 3-(dimethylamino)-1-[4-[(1R,2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123800423 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 3-(dimethylamino)-1-[4-[(1R,2S)-2-[4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]phenyl]prop-2-en-1-one |
| SMILES | CN(C)C=CC(=O)c1ccc([C@]2(c3ccc(OCc4ccccn4)cc3)CC3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C30H32N2O2/c1-32(2)18-16-29(33)23-7-10-24(11-8-23)30(20-22-6-9-26(30)19-22)25-12-14-28(15-13-25)34-21-27-5-3-4-17-31-27/h3-5,7-8,10-18,22,26H,6,9,19-21H2,1-2H3/t22?,26-,30+/m1/s1 |
| InChIKey | JFHYVSREYKKKJM-DVCSDVLYSA-N |
| XLogP | 6.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|