C27H26FNO3 — CID 58095589
methyl 4-[2-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]benzoate (PubChem CID 58095589) has the molecular formula C27H26FNO3 and a molecular weight of 431.51 g/mol. Its IUPAC name is methyl 4-[2-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]benzoate.
| Compound Name | methyl 4-[2-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]benzoate |
|---|---|
| PubChem CID | 58095589 |
| Molecular Formula | C27H26FNO3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | methyl 4-[2-[2-fluoro-4-(pyridin-2-ylmethoxy)phenyl]-2-bicyclo[2.2.1]heptanyl]benzoate |
| SMILES | COC(=O)c1ccc(C2(c3ccc(OCc4ccccn4)cc3F)CC3CCC2C3)cc1 |
| InChI | InChI=1S/C27H26FNO3/c1-31-26(30)19-6-9-20(10-7-19)27(16-18-5-8-21(27)14-18)24-12-11-23(15-25(24)28)32-17-22-4-2-3-13-29-22/h2-4,6-7,9-13,15,18,21H,5,8,14,16-17H2,1H3 |
| InChIKey | UCKMNNQRQYICIC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |