C17H25FN2O3 — CID 110911555
2-methylpropyl 4-[2-(4-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate (PubChem CID 110911555) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-methylpropyl 4-[2-(4-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[2-(4-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110911555 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-methylpropyl 4-[2-(4-fluorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(CC(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H25FN2O3/c1-13(2)12-23-17(22)20-9-7-19(8-10-20)11-16(21)14-3-5-15(18)6-4-14/h3-6,13,16,21H,7-12H2,1-2H3 |
| InChIKey | LXJCAVYJPCPYCC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |