C11H27IN4 — CID 110912000
1-[2-(diethylamino)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 110912000) has the molecular formula C11H27IN4 and a molecular weight of 342.27 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110912000 |
| Molecular Formula | C11H27IN4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCN(CC)CCN/C(N)=N/CC(C)C.I |
| InChI | InChI=1S/C11H26N4.HI/c1-5-15(6-2)8-7-13-11(12)14-9-10(3)4;/h10H,5-9H2,1-4H3,(H3,12,13,14);1H |
| InChIKey | FPIFCNGQXOXILU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|