C12H16IN5 — CID 110912588
1-phenyl-2-(2-pyrazol-1-ylethyl)guanidine;hydroiodide (PubChem CID 110912588) has the molecular formula C12H16IN5 and a molecular weight of 357.20 g/mol. Its IUPAC name is 1-phenyl-2-(2-pyrazol-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-phenyl-2-(2-pyrazol-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110912588 |
| Molecular Formula | C12H16IN5 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 1-phenyl-2-(2-pyrazol-1-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCn1cccn1)Nc1ccccc1 |
| InChI | InChI=1S/C12H15N5.HI/c13-12(16-11-5-2-1-3-6-11)14-8-10-17-9-4-7-15-17;/h1-7,9H,8,10H2,(H3,13,14,16);1H |
| InChIKey | CWAVHJJHPOQNDE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|