C12H20IN3O — CID 110913273
2-[[4-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110913273) has the molecular formula C12H20IN3O and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-[[4-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110913273 |
| Molecular Formula | C12H20IN3O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[[4-(2-methylpropoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CC(C)COc1ccc(CN=C(N)N)cc1.I |
| InChI | InChI=1S/C12H19N3O.HI/c1-9(2)8-16-11-5-3-10(4-6-11)7-15-12(13)14;/h3-6,9H,7-8H2,1-2H3,(H4,13,14,15);1H |
| InChIKey | KAEMSMIFEBUJMK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|