C13H18N6O — CID 110915027
1-(2-methoxyethyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 110915027) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-(2-methoxyethyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 110915027 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | COCCN/C(N)=N/Cc1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C13H18N6O/c1-20-8-6-16-13(14)17-10-11-3-5-15-12(9-11)19-7-2-4-18-19/h2-5,7,9H,6,8,10H2,1H3,(H3,14,16,17) |
| InChIKey | NRKQJLXQBMCCHS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|