C19H30N2O3 — CID 110921573
N-[1-[2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-3-yl]-2-methylpropanamide (PubChem CID 110921573) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[1-[2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-3-yl]-2-methylpropanamide.
| Compound Name | N-[1-[2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110921573 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-[1-[2-hydroxy-3-(2-methylphenoxy)propyl]piperidin-3-yl]-2-methylpropanamide |
| SMILES | Cc1ccccc1OCC(O)CN1CCCC(NC(=O)C(C)C)C1 |
| InChI | InChI=1S/C19H30N2O3/c1-14(2)19(23)20-16-8-6-10-21(11-16)12-17(22)13-24-18-9-5-4-7-15(18)3/h4-5,7,9,14,16-17,22H,6,8,10-13H2,1-3H3,(H,20,23) |
| InChIKey | MARXDFWUUDBOFG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |