C16H20N2O5 — CID 110922607
2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylamino]butan-1-ol (PubChem CID 110922607) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylamino]butan-1-ol.
| Compound Name | 2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 110922607 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylamino]butan-1-ol |
| SMILES | CCC(CO)NCc1ccc(-c2ccc(OC)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H20N2O5/c1-3-11(10-19)17-9-13-5-7-16(23-13)14-6-4-12(22-2)8-15(14)18(20)21/h4-8,11,17,19H,3,9-10H2,1-2H3 |
| InChIKey | IJQGPAVTMLQTRA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|