C24H33ClO9 — CID 11092325
[(1S,2S,3R,4R,7S,8E,12S,13S,14S,16S,18R)-14-acetyloxy-9-(chloromethyl)-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate (PubChem CID 11092325) has the molecular formula C24H33ClO9 and a molecular weight of 500.97 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7S,8E,12S,13S,14S,16S,18R)-14-acetyloxy-9-(chloromethyl)-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7S,8E,12S,13S,14S,16S,18R)-14-acetyloxy-9-(chloromethyl)-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate |
|---|---|
| PubChem CID | 11092325 |
| Molecular Formula | C24H33ClO9 |
| Molecular Weight | 500.97 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [(1S,2S,3R,4R,7S,8E,12S,13S,14S,16S,18R)-14-acetyloxy-9-(chloromethyl)-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC/C(CCl)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@@H](O)[C@H]2[C@@]3(C)O[C@H]3C[C@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C24H33ClO9/c1-11-21(29)33-18-8-14(10-25)6-7-15(31-12(2)26)22(4)16(32-13(3)27)9-17-23(5,34-17)19(22)20(28)24(11,18)30/h8,11,15-20,28,30H,6-7,9-10H2,1-5H3/b14-8+/t11-,15-,16-,17-,18-,19+,20-,22-,23-,24-/m0/s1 |
| InChIKey | OXTYHQSZSJELED-PIXLWAKVSA-N |
| XLogP | 1.65 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.97 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|