C12H16F2N2O3 — CID 110923302
1-[3-(2,2-difluoroethoxy)-4-methylphenyl]-3-(2-hydroxyethyl)urea (PubChem CID 110923302) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-[3-(2,2-difluoroethoxy)-4-methylphenyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[3-(2,2-difluoroethoxy)-4-methylphenyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110923302 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[3-(2,2-difluoroethoxy)-4-methylphenyl]-3-(2-hydroxyethyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCO)cc1OCC(F)F |
| InChI | InChI=1S/C12H16F2N2O3/c1-8-2-3-9(16-12(18)15-4-5-17)6-10(8)19-7-11(13)14/h2-3,6,11,17H,4-5,7H2,1H3,(H2,15,16,18) |
| InChIKey | BQMJHXRAICHSRK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |