C15H20F2N2O2 — CID 119314646
N-[3-(2,2-difluoroethoxy)-4-methylphenyl]piperidine-4-carboxamide (PubChem CID 119314646) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-4-methylphenyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-4-methylphenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119314646 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-4-methylphenyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCNCC2)cc1OCC(F)F |
| InChI | InChI=1S/C15H20F2N2O2/c1-10-2-3-12(8-13(10)21-9-14(16)17)19-15(20)11-4-6-18-7-5-11/h2-3,8,11,14,18H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | MMWJZSUPLLVEAP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |