C20H34N4 — CID 110925686
2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1,3-diethylguanidine (PubChem CID 110925686) has the molecular formula C20H34N4 and a molecular weight of 330.52 g/mol. Its IUPAC name is 2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1,3-diethylguanidine.
| Compound Name | 2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 110925686 |
| Molecular Formula | C20H34N4 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCc1ccc(CN2CC(C)CC(C)C2)cc1)NCC |
| InChI | InChI=1S/C20H34N4/c1-5-21-20(22-6-2)23-12-18-7-9-19(10-8-18)15-24-13-16(3)11-17(4)14-24/h7-10,16-17H,5-6,11-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | OXXLJIVQSCBMNB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|