C23H37N5O2 — CID 111929055
2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111929055) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111929055 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CC(C)OC(C)C2)cc1)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C23H37N5O2/c1-4-24-23(26-14-22(29)28-11-5-6-12-28)25-13-20-7-9-21(10-8-20)17-27-15-18(2)30-19(3)16-27/h7-10,18-19H,4-6,11-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | RRZVUCPNUUASMP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|