C24H43IN4O2 — CID 111712920
2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide (PubChem CID 111712920) has the molecular formula C24H43IN4O2 and a molecular weight of 546.54 g/mol. Its IUPAC name is 2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111712920 |
| Molecular Formula | C24H43IN4O2 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 2-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]-1-ethyl-3-[2-(2-hydroxyethyl)pentyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)CN/C(=N/Cc1ccc(CN2CC(C)OC(C)C2)cc1)NCC.I |
| InChI | InChI=1S/C24H42N4O2.HI/c1-5-7-21(12-13-29)14-26-24(25-6-2)27-15-22-8-10-23(11-9-22)18-28-16-19(3)30-20(4)17-28;/h8-11,19-21,29H,5-7,12-18H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | HYOKNJYJQUVGEN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|