C13H14F3N3O3 — CID 110930883
2-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-3-(trifluoromethyl)phenoxy]ethanol (PubChem CID 110930883) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-3-(trifluoromethyl)phenoxy]ethanol.
| Compound Name | 2-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-3-(trifluoromethyl)phenoxy]ethanol |
|---|---|
| PubChem CID | 110930883 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]-3-(trifluoromethyl)phenoxy]ethanol |
| SMILES | Cc1noc(CNc2ccc(OCCO)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C13H14F3N3O3/c1-8-18-12(22-19-8)7-17-11-3-2-9(21-5-4-20)6-10(11)13(14,15)16/h2-3,6,17,20H,4-5,7H2,1H3 |
| InChIKey | VUHSQNCTRXFEFM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|