C16H23F3N2O3 — CID 111111172
2-[4-(2-hydroxyethoxy)-2-(trifluoromethyl)anilino]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 111111172) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)-2-(trifluoromethyl)anilino]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[4-(2-hydroxyethoxy)-2-(trifluoromethyl)anilino]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 111111172 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)-2-(trifluoromethyl)anilino]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CNc1ccc(OCCO)cc1C(F)(F)F |
| InChI | InChI=1S/C16H23F3N2O3/c1-4-15(2,3)21-14(23)10-20-13-6-5-11(24-8-7-22)9-12(13)16(17,18)19/h5-6,9,20,22H,4,7-8,10H2,1-3H3,(H,21,23) |
| InChIKey | YHRAPQJEJAVXCM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|