C33H55NO6Si — CID 11093146
(4S)-4-benzyl-3-[(E,2S,3R,5R,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-7-methoxy-6,8-dimethyldodec-10-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11093146) has the molecular formula C33H55NO6Si and a molecular weight of 589.89 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,2S,3R,5R,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-7-methoxy-6,8-dimethyldodec-10-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,2S,3R,5R,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-7-methoxy-6,8-dimethyldodec-10-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11093146 |
| Molecular Formula | C33H55NO6Si |
| Molecular Weight | 589.89 g/mol |
| Exact Mass | 589.38 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,2S,3R,5R,6R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-7-methoxy-6,8-dimethyldodec-10-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@@H](O)[C@H](CC)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H55NO6Si/c1-11-13-17-23(3)30(38-8)24(4)29(40-41(9,10)33(5,6)7)21-28(35)27(12-2)31(36)34-26(22-39-32(34)37)20-25-18-15-14-16-19-25/h11,13-16,18-19,23-24,26-30,35H,12,17,20-22H2,1-10H3/b13-11+/t23-,24-,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | ZSGKIXWKEQBTGO-MIZOXVLRSA-N |
| XLogP | 7.00 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.89 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|