C13H23IN4O2 — CID 110934822
1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 110934822) has the molecular formula C13H23IN4O2 and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110934822 |
| Molecular Formula | C13H23IN4O2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccco1)NCC1CN(C)CCO1.I |
| InChI | InChI=1S/C13H22N4O2.HI/c1-14-13(15-8-11-4-3-6-18-11)16-9-12-10-17(2)5-7-19-12;/h3-4,6,12H,5,7-10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | QKMQDOWLARITRY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|