C19H31FIN5O2 — CID 119141454
1-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119141454) has the molecular formula C19H31FIN5O2 and a molecular weight of 507.39 g/mol. Its IUPAC name is 1-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119141454 |
| Molecular Formula | C19H31FIN5O2 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(F)ccc1N1CCOCC1)NCC1CN(C)CCO1.I |
| InChI | InChI=1S/C19H30FN5O2.HI/c1-21-19(23-13-17-14-24(2)5-10-27-17)22-12-15-11-16(20)3-4-18(15)25-6-8-26-9-7-25;/h3-4,11,17H,5-10,12-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | SAFRZWJCRBQBCG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|