C37H54F3NO3Si — CID 11093495
N-[(2S,3R,4E,8E)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-methyloctadeca-4,8-dien-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 11093495) has the molecular formula C37H54F3NO3Si and a molecular weight of 645.92 g/mol. Its IUPAC name is N-[(2S,3R,4E,8E)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-methyloctadeca-4,8-dien-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4E,8E)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-methyloctadeca-4,8-dien-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11093495 |
| Molecular Formula | C37H54F3NO3Si |
| Molecular Weight | 645.92 g/mol |
| Exact Mass | 645.38 |
| IUPAC Name | N-[(2S,3R,4E,8E)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-9-methyloctadeca-4,8-dien-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCCCCCC/C(C)=C/CC/C=C/[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](CO)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C37H54F3NO3Si/c1-6-7-8-9-10-11-15-22-30(2)23-16-12-21-28-34(33(29-42)41-35(43)37(38,39)40)44-45(36(3,4)5,31-24-17-13-18-25-31)32-26-19-14-20-27-32/h13-14,17-21,23-28,33-34,42H,6-12,15-16,22,29H2,1-5H3,(H,41,43)/b28-21+,30-23+/t33-,34+/m0/s1 |
| InChIKey | FBKSPOLXQLNPSK-QSRLYNHCSA-N |
| XLogP | 8.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.92 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|